C31H42Cl2N6O5 — CID 159641919
3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid (PubChem CID 159641919) has the molecular formula C31H42Cl2N6O5 and a molecular weight of 649.62 g/mol. Its IUPAC name is 3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid.
| Compound Name | 3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 159641919 |
| Molecular Formula | C31H42Cl2N6O5 |
| Molecular Weight | 649.62 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | 3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid |
| SMILES | Cc1ccnc(NCCCCC(=O)NCC(=O)CC(CC(=O)O)c2cc(Cl)c(OCCCCCCCCN=[N+]=[N-])c(Cl)c2)c1 |
| InChI | InChI=1S/C31H42Cl2N6O5/c1-22-11-14-36-28(16-22)35-12-8-6-10-29(41)37-21-25(40)17-23(20-30(42)43)24-18-26(32)31(27(33)19-24)44-15-9-5-3-2-4-7-13-38-39-34/h11,14,16,18-19,23H,2-10,12-13,15,17,20-21H2,1H3,(H,35,36)(H,37,41)(H,42,43) |
| InChIKey | MQLRNTMKLRRTRE-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.62 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|