C27H30N6O3 — CID 159647622
7-[3-(6-aminohexylcarbamoyl)phenyl]-2-(4-methylphenyl)-6-oxo-5H-pyrrolo[2,3-d]pyrimidine-4-carboxamide (PubChem CID 159647622) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 7-[3-(6-aminohexylcarbamoyl)phenyl]-2-(4-methylphenyl)-6-oxo-5H-pyrrolo[2,3-d]pyrimidine-4-carboxamide.
| Compound Name | 7-[3-(6-aminohexylcarbamoyl)phenyl]-2-(4-methylphenyl)-6-oxo-5H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 159647622 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 7-[3-(6-aminohexylcarbamoyl)phenyl]-2-(4-methylphenyl)-6-oxo-5H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(N)=O)c3c(n2)N(c2cccc(C(=O)NCCCCCCN)c2)C(=O)C3)cc1 |
| InChI | InChI=1S/C27H30N6O3/c1-17-9-11-18(12-10-17)25-31-23(24(29)35)21-16-22(34)33(26(21)32-25)20-8-6-7-19(15-20)27(36)30-14-5-3-2-4-13-28/h6-12,15H,2-5,13-14,16,28H2,1H3,(H2,29,35)(H,30,36) |
| InChIKey | HGFFTMUQJXCVOR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|