C25H23N5O — CID 164898062
N-(3-aminopropyl)-2-(4-cyanophenyl)-1-(4-methylphenyl)benzimidazole-5-carboxamide (PubChem CID 164898062) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(4-cyanophenyl)-1-(4-methylphenyl)benzimidazole-5-carboxamide.
| Compound Name | N-(3-aminopropyl)-2-(4-cyanophenyl)-1-(4-methylphenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 164898062 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-(3-aminopropyl)-2-(4-cyanophenyl)-1-(4-methylphenyl)benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccc(C#N)cc3)nc3cc(C(=O)NCCCN)ccc32)cc1 |
| InChI | InChI=1S/C25H23N5O/c1-17-3-10-21(11-4-17)30-23-12-9-20(25(31)28-14-2-13-26)15-22(23)29-24(30)19-7-5-18(16-27)6-8-19/h3-12,15H,2,13-14,26H2,1H3,(H,28,31) |
| InChIKey | TULSKUJPUXEANM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|