C26H23NO5 — CID 159647654
7-(2-hydroxyacetyl)-2-[2-(4-phenylmethoxyphenoxy)ethyl]isoquinolin-1-one (PubChem CID 159647654) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is 7-(2-hydroxyacetyl)-2-[2-(4-phenylmethoxyphenoxy)ethyl]isoquinolin-1-one.
| Compound Name | 7-(2-hydroxyacetyl)-2-[2-(4-phenylmethoxyphenoxy)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 159647654 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 7-(2-hydroxyacetyl)-2-[2-(4-phenylmethoxyphenoxy)ethyl]isoquinolin-1-one |
| SMILES | O=C(CO)c1ccc2ccn(CCOc3ccc(OCc4ccccc4)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C26H23NO5/c28-17-25(29)21-7-6-20-12-13-27(26(30)24(20)16-21)14-15-31-22-8-10-23(11-9-22)32-18-19-4-2-1-3-5-19/h1-13,16,28H,14-15,17-18H2 |
| InChIKey | JNDOUPZDEXVSRS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |