C17H16Cl2O4 — CID 159649877
2-(chloromethyl)-5-[(4-chlorophenyl)methyl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 159649877) has the molecular formula C17H16Cl2O4 and a molecular weight of 355.22 g/mol. Its IUPAC name is 2-(chloromethyl)-5-[(4-chlorophenyl)methyl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 2-(chloromethyl)-5-[(4-chlorophenyl)methyl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 159649877 |
| Molecular Formula | C17H16Cl2O4 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-(chloromethyl)-5-[(4-chlorophenyl)methyl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(CCl)C(C(=O)O)=CC(Cc2ccc(Cl)cc2)=CC1C(=O)O |
| InChI | InChI=1S/C17H16Cl2O4/c1-17(9-18)13(15(20)21)7-11(8-14(17)16(22)23)6-10-2-4-12(19)5-3-10/h2-5,7-8,13H,6,9H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | XZXVONSUCVLUPC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|