C15H13ClO2 — CID 174717809
4-[(4-chlorophenyl)methyl]-2-hydroxycyclohepta-2,4,6-triene-1-carbaldehyde (PubChem CID 174717809) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-hydroxycyclohepta-2,4,6-triene-1-carbaldehyde.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-hydroxycyclohepta-2,4,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 174717809 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-hydroxycyclohepta-2,4,6-triene-1-carbaldehyde |
| SMILES | O=CC1C=CC=C(Cc2ccc(Cl)cc2)C=C1O |
| InChI | InChI=1S/C15H13ClO2/c16-14-6-4-11(5-7-14)8-12-2-1-3-13(10-17)15(18)9-12/h1-7,9-10,13,18H,8H2 |
| InChIKey | IOAOLXHMJHQRHA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|