C16H21ClO3 — CID 142954611
4-[(4-chlorophenyl)methyl]-5-hydroxycyclohept-4-ene-1-carbaldehyde;methanol (PubChem CID 142954611) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-5-hydroxycyclohept-4-ene-1-carbaldehyde;methanol.
| Compound Name | 4-[(4-chlorophenyl)methyl]-5-hydroxycyclohept-4-ene-1-carbaldehyde;methanol |
|---|---|
| PubChem CID | 142954611 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-5-hydroxycyclohept-4-ene-1-carbaldehyde;methanol |
| SMILES | CO.O=CC1CCC(O)=C(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H17ClO2.CH4O/c16-14-6-2-11(3-7-14)9-13-5-1-12(10-17)4-8-15(13)18;1-2/h2-3,6-7,10,12,18H,1,4-5,8-9H2;2H,1H3 |
| InChIKey | TYXJUOQYAFTCQK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|