C16H23ClO2 — CID 161000448
[2-[(4-chlorophenyl)methyl]-5,5-dimethylcyclopenten-1-yl]methanol;methanol (PubChem CID 161000448) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methyl]-5,5-dimethylcyclopenten-1-yl]methanol;methanol.
| Compound Name | [2-[(4-chlorophenyl)methyl]-5,5-dimethylcyclopenten-1-yl]methanol;methanol |
|---|---|
| PubChem CID | 161000448 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [2-[(4-chlorophenyl)methyl]-5,5-dimethylcyclopenten-1-yl]methanol;methanol |
| SMILES | CC1(C)CCC(Cc2ccc(Cl)cc2)=C1CO.CO |
| InChI | InChI=1S/C15H19ClO.CH4O/c1-15(2)8-7-12(14(15)10-17)9-11-3-5-13(16)6-4-11;1-2/h3-6,17H,7-10H2,1-2H3;2H,1H3 |
| InChIKey | TVUMEARCCAXXKR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|