About 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine
3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine (PubChem CID 159650313) has the molecular formula C22H18BBrCl2N2O2
and a molecular weight of 504.02 g/mol. Its IUPAC name is 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine.
Molecular Properties
| Compound Name | 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine |
| PubChem CID | 159650313 |
| Molecular Formula | C22H18BBrCl2N2O2 |
| Molecular Weight | 504.02 g/mol |
| Exact Mass | 502.00 |
| IUPAC Name | 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine |
| SMILES | Brc1cccnc1.Clc1ccc(-c2cccnc2)cc1.OB(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H8ClN.C6H6BClO2.C5H4BrN/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10;8-6-3-1-5(2-4-6)7(9)10;6-5-2-1-3-7-4-5/h1-8H;1-4,9-10H;1-4H |
| InChIKey | MRMCMBPMKAAANE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine?
The IUPAC name of 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine (CID 159650313) is 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine.
What is the SMILES notation for 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine?
The canonical SMILES for 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine is Brc1cccnc1.Clc1ccc(-c2cccnc2)cc1.OB(O)c1ccc(Cl)cc1.
What is the InChIKey of 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine?
The InChIKey is MRMCMBPMKAAANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN.C6H6BClO2.C5H4BrN/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10;8-6-3-1-5(2-4-6)7(9)10;6-5-2-1-3-7-4-5/h1-8H;1-4,9-10H;1-4H.
What are the key properties of 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine?
3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine has a molecular weight of 504.02 g/mol, XLogP of 5.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyridine;(4-chlorophenyl)boronic acid;3-(4-chlorophenyl)pyridine is sourced from PubChem (CID 159650313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).