C19H29NO — CID 159650765
1-benzyl-4-(2,2-dimethyloxan-4-yl)piperidine (PubChem CID 159650765) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-benzyl-4-(2,2-dimethyloxan-4-yl)piperidine.
| Compound Name | 1-benzyl-4-(2,2-dimethyloxan-4-yl)piperidine |
|---|---|
| PubChem CID | 159650765 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-benzyl-4-(2,2-dimethyloxan-4-yl)piperidine |
| SMILES | CC1(C)CC(C2CCN(Cc3ccccc3)CC2)CCO1 |
| InChI | InChI=1S/C19H29NO/c1-19(2)14-18(10-13-21-19)17-8-11-20(12-9-17)15-16-6-4-3-5-7-16/h3-7,17-18H,8-15H2,1-2H3 |
| InChIKey | MRNRCJANCDAGEZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |