C25H34N4O4S — CID 159652116
2-[1H-indol-7-ylmethyl(methyl)amino]ethanol;2-[1H-indol-7-ylmethyl(methyl)amino]ethyl methanesulfonate (PubChem CID 159652116) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[1H-indol-7-ylmethyl(methyl)amino]ethanol;2-[1H-indol-7-ylmethyl(methyl)amino]ethyl methanesulfonate.
| Compound Name | 2-[1H-indol-7-ylmethyl(methyl)amino]ethanol;2-[1H-indol-7-ylmethyl(methyl)amino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 159652116 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[1H-indol-7-ylmethyl(methyl)amino]ethanol;2-[1H-indol-7-ylmethyl(methyl)amino]ethyl methanesulfonate |
| SMILES | CN(CCO)Cc1cccc2cc[nH]c12.CN(CCOS(C)(=O)=O)Cc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C13H18N2O3S.C12H16N2O/c1-15(8-9-18-19(2,16)17)10-12-5-3-4-11-6-7-14-13(11)12;1-14(7-8-15)9-11-4-2-3-10-5-6-13-12(10)11/h3-7,14H,8-10H2,1-2H3;2-6,13,15H,7-9H2,1H3 |
| InChIKey | MRRWQRCSSRHPDW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|