C14H12ClKN2S2 — CID 159653077
potassium;5-chloro-4-naphthalen-1-yl-1,3-thiazol-2-amine;methanethiolate (PubChem CID 159653077) has the molecular formula C14H12ClKN2S2 and a molecular weight of 346.95 g/mol. Its IUPAC name is potassium;5-chloro-4-naphthalen-1-yl-1,3-thiazol-2-amine;methanethiolate.
| Compound Name | potassium;5-chloro-4-naphthalen-1-yl-1,3-thiazol-2-amine;methanethiolate |
|---|---|
| PubChem CID | 159653077 |
| Molecular Formula | C14H12ClKN2S2 |
| Molecular Weight | 346.95 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | potassium;5-chloro-4-naphthalen-1-yl-1,3-thiazol-2-amine;methanethiolate |
| SMILES | C[S-].Nc1nc(-c2cccc3ccccc23)c(Cl)s1.[K+] |
| InChI | InChI=1S/C13H9ClN2S.CH4S.K/c14-12-11(16-13(15)17-12)10-7-3-5-8-4-1-2-6-9(8)10;1-2;/h1-7H,(H2,15,16);2H,1H3;/q;;+1/p-1 |
| InChIKey | MRVAQBUZEHOZOY-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.95 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|