C15H12N2O2S — CID 175338698
2-(2-amino-5-naphthalen-1-yl-1,3-thiazol-4-yl)acetic acid (PubChem CID 175338698) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(2-amino-5-naphthalen-1-yl-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-(2-amino-5-naphthalen-1-yl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 175338698 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-(2-amino-5-naphthalen-1-yl-1,3-thiazol-4-yl)acetic acid |
| SMILES | Nc1nc(CC(=O)O)c(-c2cccc3ccccc23)s1 |
| InChI | InChI=1S/C15H12N2O2S/c16-15-17-12(8-13(18)19)14(20-15)11-7-3-5-9-4-1-2-6-10(9)11/h1-7H,8H2,(H2,16,17)(H,18,19) |
| InChIKey | OOEBUHXIRPJLBJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |