C10H10FN3S — CID 133054887
4-(aminomethyl)-5-(2-fluorophenyl)-1,3-thiazol-2-amine (PubChem CID 133054887) has the molecular formula C10H10FN3S and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-(aminomethyl)-5-(2-fluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(aminomethyl)-5-(2-fluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133054887 |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-(aminomethyl)-5-(2-fluorophenyl)-1,3-thiazol-2-amine |
| SMILES | NCc1nc(N)sc1-c1ccccc1F |
| InChI | InChI=1S/C10H10FN3S/c11-7-4-2-1-3-6(7)9-8(5-12)14-10(13)15-9/h1-4H,5,12H2,(H2,13,14) |
| InChIKey | RTCAKHKRLSVXKW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |