C10H6ClFINS — CID 133055279
4-(chloromethyl)-5-(2-fluorophenyl)-2-iodo-1,3-thiazole (PubChem CID 133055279) has the molecular formula C10H6ClFINS and a molecular weight of 353.59 g/mol. Its IUPAC name is 4-(chloromethyl)-5-(2-fluorophenyl)-2-iodo-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-5-(2-fluorophenyl)-2-iodo-1,3-thiazole |
|---|---|
| PubChem CID | 133055279 |
| Molecular Formula | C10H6ClFINS |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 352.89 |
| IUPAC Name | 4-(chloromethyl)-5-(2-fluorophenyl)-2-iodo-1,3-thiazole |
| SMILES | Fc1ccccc1-c1sc(I)nc1CCl |
| InChI | InChI=1S/C10H6ClFINS/c11-5-8-9(15-10(13)14-8)6-3-1-2-4-7(6)12/h1-4H,5H2 |
| InChIKey | KILYEPGFBOUAFI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|