C16H9F2NO2S — CID 46313729
2,5-bis(2-fluorophenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 46313729) has the molecular formula C16H9F2NO2S and a molecular weight of 317.32 g/mol. Its IUPAC name is 2,5-bis(2-fluorophenyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2,5-bis(2-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 46313729 |
| Molecular Formula | C16H9F2NO2S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2,5-bis(2-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccccc2F)sc1-c1ccccc1F |
| InChI | InChI=1S/C16H9F2NO2S/c17-11-7-3-1-5-9(11)14-13(16(20)21)19-15(22-14)10-6-2-4-8-12(10)18/h1-8H,(H,20,21) |
| InChIKey | YOKMRUCQEHANDR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |