C10H5Cl2FS — CID 175608804
2,3-dichloro-5-(2-fluorophenyl)thiophene (PubChem CID 175608804) has the molecular formula C10H5Cl2FS and a molecular weight of 247.12 g/mol. Its IUPAC name is 2,3-dichloro-5-(2-fluorophenyl)thiophene.
| Compound Name | 2,3-dichloro-5-(2-fluorophenyl)thiophene |
|---|---|
| PubChem CID | 175608804 |
| Molecular Formula | C10H5Cl2FS |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 2,3-dichloro-5-(2-fluorophenyl)thiophene |
| SMILES | Fc1ccccc1-c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H5Cl2FS/c11-7-5-9(14-10(7)12)6-3-1-2-4-8(6)13/h1-5H |
| InChIKey | DUTGBHKNBWUTOF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |