C4HCl2FS — CID 129040028
2,3-dichloro-5-fluorothiophene (PubChem CID 129040028) has the molecular formula C4HCl2FS and a molecular weight of 171.02 g/mol. Its IUPAC name is 2,3-dichloro-5-fluorothiophene.
| Compound Name | 2,3-dichloro-5-fluorothiophene |
|---|---|
| PubChem CID | 129040028 |
| Molecular Formula | C4HCl2FS |
| Molecular Weight | 171.02 g/mol |
| Exact Mass | 169.92 |
| IUPAC Name | 2,3-dichloro-5-fluorothiophene |
| SMILES | Fc1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C4HCl2FS/c5-2-1-3(7)8-4(2)6/h1H |
| InChIKey | FXTMDURQPQXWRI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.02 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |