C4H3Cl3O3S2 — CID 174395716
4,5-dichlorothiophene-2-sulfonic acid;hydrochloride (PubChem CID 174395716) has the molecular formula C4H3Cl3O3S2 and a molecular weight of 269.56 g/mol. Its IUPAC name is 4,5-dichlorothiophene-2-sulfonic acid;hydrochloride.
| Compound Name | 4,5-dichlorothiophene-2-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174395716 |
| Molecular Formula | C4H3Cl3O3S2 |
| Molecular Weight | 269.56 g/mol |
| Exact Mass | 267.86 |
| IUPAC Name | 4,5-dichlorothiophene-2-sulfonic acid;hydrochloride |
| SMILES | Cl.O=S(=O)(O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C4H2Cl2O3S2.ClH/c5-2-1-3(10-4(2)6)11(7,8)9;/h1H,(H,7,8,9);1H |
| InChIKey | SQTBGPIMOKKJDJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|