C10H17Cl2NO2S2Si — CID 142522627
N-[tert-butyl(dimethyl)silyl]-4,5-dichlorothiophene-2-sulfonamide (PubChem CID 142522627) has the molecular formula C10H17Cl2NO2S2Si and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-4,5-dichlorothiophene-2-sulfonamide.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-4,5-dichlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 142522627 |
| Molecular Formula | C10H17Cl2NO2S2Si |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-4,5-dichlorothiophene-2-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H17Cl2NO2S2Si/c1-10(2,3)18(4,5)13-17(14,15)8-6-7(11)9(12)16-8/h6,13H,1-5H3 |
| InChIKey | NFCWGFUMBUCVOS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|