C17H32N2O2SSi — CID 151759845
N-[tert-butyl(dimethyl)silyl]-4-[2-(dimethylamino)propan-2-yl]benzenesulfonamide (PubChem CID 151759845) has the molecular formula C17H32N2O2SSi and a molecular weight of 356.61 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-4-[2-(dimethylamino)propan-2-yl]benzenesulfonamide.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-4-[2-(dimethylamino)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 151759845 |
| Molecular Formula | C17H32N2O2SSi |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-4-[2-(dimethylamino)propan-2-yl]benzenesulfonamide |
| SMILES | CN(C)C(C)(C)c1ccc(S(=O)(=O)N[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H32N2O2SSi/c1-16(2,3)23(8,9)18-22(20,21)15-12-10-14(11-13-15)17(4,5)19(6)7/h10-13,18H,1-9H3 |
| InChIKey | RQIDAEGFDZXAEN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|