C12H21NO5SSi — CID 170717835
methyl 5-[[tert-butyl(dimethyl)silyl]sulfamoyl]furan-3-carboxylate (PubChem CID 170717835) has the molecular formula C12H21NO5SSi and a molecular weight of 319.46 g/mol. Its IUPAC name is methyl 5-[[tert-butyl(dimethyl)silyl]sulfamoyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[tert-butyl(dimethyl)silyl]sulfamoyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 170717835 |
| Molecular Formula | C12H21NO5SSi |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | methyl 5-[[tert-butyl(dimethyl)silyl]sulfamoyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(S(=O)(=O)N[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C12H21NO5SSi/c1-12(2,3)20(5,6)13-19(15,16)10-7-9(8-18-10)11(14)17-4/h7-8,13H,1-6H3 |
| InChIKey | IFBXBXKSXCFAQI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|