C10H18Cl2N2OS2Si — CID 142522975
5-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-2,3-dichlorothiophene (PubChem CID 142522975) has the molecular formula C10H18Cl2N2OS2Si and a molecular weight of 345.39 g/mol. Its IUPAC name is 5-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-2,3-dichlorothiophene.
| Compound Name | 5-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-2,3-dichlorothiophene |
|---|---|
| PubChem CID | 142522975 |
| Molecular Formula | C10H18Cl2N2OS2Si |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 5-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]-2,3-dichlorothiophene |
| SMILES | [H]N=S(=O)(N[Si](C)(C)C(C)(C)C)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H18Cl2N2OS2Si/c1-10(2,3)18(4,5)14-17(13,15)8-6-7(11)9(12)16-8/h6H,1-5H3,(H2,13,14,15) |
| InChIKey | IVYKAAGRPCHLHI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|