C9H9FN4 — CID 83484089
[5-(2-fluorophenyl)-2H-triazol-4-yl]methanamine (PubChem CID 83484089) has the molecular formula C9H9FN4 and a molecular weight of 192.20 g/mol. Its IUPAC name is [5-(2-fluorophenyl)-2H-triazol-4-yl]methanamine.
| Compound Name | [5-(2-fluorophenyl)-2H-triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 83484089 |
| Molecular Formula | C9H9FN4 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | [5-(2-fluorophenyl)-2H-triazol-4-yl]methanamine |
| SMILES | NCc1n[nH]nc1-c1ccccc1F |
| InChI | InChI=1S/C9H9FN4/c10-7-4-2-1-3-6(7)9-8(5-11)12-14-13-9/h1-4H,5,11H2,(H,12,13,14) |
| InChIKey | WIIIGNHVMXZPMF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |