C11H11N9S — CID 159657386
8-methylsulfanyl-7H-purine;7H-purin-8-amine (PubChem CID 159657386) has the molecular formula C11H11N9S and a molecular weight of 301.34 g/mol. Its IUPAC name is 8-methylsulfanyl-7H-purine;7H-purin-8-amine.
| Compound Name | 8-methylsulfanyl-7H-purine;7H-purin-8-amine |
|---|---|
| PubChem CID | 159657386 |
| Molecular Formula | C11H11N9S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 8-methylsulfanyl-7H-purine;7H-purin-8-amine |
| SMILES | CSc1nc2ncncc2[nH]1.Nc1nc2ncncc2[nH]1 |
| InChI | InChI=1S/C6H6N4S.C5H5N5/c1-11-6-9-4-2-7-3-8-5(4)10-6;6-5-9-3-1-7-2-8-4(3)10-5/h2-3H,1H3,(H,7,8,9,10);1-2H,(H3,6,7,8,9,10) |
| InChIKey | MSIQVYZBXMSCFG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |