C8H11N5S — CID 119091949
N,N-dimethyl-8-methylsulfanyl-7H-purin-2-amine (PubChem CID 119091949) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is N,N-dimethyl-8-methylsulfanyl-7H-purin-2-amine.
| Compound Name | N,N-dimethyl-8-methylsulfanyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 119091949 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N,N-dimethyl-8-methylsulfanyl-7H-purin-2-amine |
| SMILES | CSc1nc2nc(N(C)C)ncc2[nH]1 |
| InChI | InChI=1S/C8H11N5S/c1-13(2)7-9-4-5-6(11-7)12-8(10-5)14-3/h4H,1-3H3,(H,9,10,11,12) |
| InChIKey | NQWBMTVRXOHXGZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |