C10H16N4 — CID 143020350
2,8-dimethyl-7H-purine;propane (PubChem CID 143020350) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 2,8-dimethyl-7H-purine;propane.
| Compound Name | 2,8-dimethyl-7H-purine;propane |
|---|---|
| PubChem CID | 143020350 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2,8-dimethyl-7H-purine;propane |
| SMILES | CCC.Cc1ncc2[nH]c(C)nc2n1 |
| InChI | InChI=1S/C7H8N4.C3H8/c1-4-8-3-6-7(10-4)11-5(2)9-6;1-3-2/h3H,1-2H3,(H,8,9,10,11);3H2,1-2H3 |
| InChIKey | XMCDRVFMAXOVJL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |