C48H44 — CID 159662189
9,10-dimethylanthracene;1-methyl-4-[(E)-2-(4-methylphenyl)ethenyl]benzene;1-methyl-4-[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 159662189) has the molecular formula C48H44 and a molecular weight of 620.88 g/mol. Its IUPAC name is 9,10-dimethylanthracene;1-methyl-4-[(E)-2-(4-methylphenyl)ethenyl]benzene;1-methyl-4-[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 9,10-dimethylanthracene;1-methyl-4-[(E)-2-(4-methylphenyl)ethenyl]benzene;1-methyl-4-[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 159662189 |
| Molecular Formula | C48H44 |
| Molecular Weight | 620.88 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | 9,10-dimethylanthracene;1-methyl-4-[(E)-2-(4-methylphenyl)ethenyl]benzene;1-methyl-4-[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | Cc1c2ccccc2c(C)c2ccccc12.Cc1ccc(/C=C/c2ccc(C)cc2)cc1.Cc1ccc(C#Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H14.C16H16.C16H14/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16;2*1-13-3-7-15(8-4-13)11-12-16-9-5-14(2)6-10-16/h3-10H,1-2H3;3-12H,1-2H3;3-10H,1-2H3/b;12-11+; |
| InChIKey | MSYKDTLUBZTBMR-ITTKMUPFSA-N |
| XLogP | 12.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.88 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|