C68H57N5 — CID 159662334
9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-dimethylpyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole (PubChem CID 159662334) has the molecular formula C68H57N5 and a molecular weight of 944.24 g/mol. Its IUPAC name is 9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-dimethylpyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole.
| Compound Name | 9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-dimethylpyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole |
|---|---|
| PubChem CID | 159662334 |
| Molecular Formula | C68H57N5 |
| Molecular Weight | 944.24 g/mol |
| Exact Mass | 943.46 |
| IUPAC Name | 9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-dimethylpyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole |
| SMILES | Cc1cc(C)nc(-c2cc(-c3cccc(-n4c5ccccc5c5ccccc54)c3)c(-n3c4c(C)c(C)c(C)c(C)c4c4c(C)c(C)c(C)c(C)c43)c(-c3cccc(-n4c5ccccc5c5ccccc54)c3)c2)n1 |
| InChI | InChI=1S/C68H57N5/c1-38-33-39(2)70-68(69-38)50-36-57(48-21-19-23-51(34-48)71-59-29-15-11-25-53(59)54-26-12-16-30-60(54)71)67(73-65-46(9)42(5)40(3)44(7)63(65)64-45(8)41(4)43(6)47(10)66(64)73)58(37-50)49-22-20-24-52(35-49)72-61-31-17-13-27-55(61)56-28-14-18-32-62(56)72/h11-37H,1-10H3 |
| InChIKey | HPNQHWPFJSPPGX-UHFFFAOYSA-N |
| XLogP | 17.85 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.24 |
| LogP ≤ 5 | 17.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |