C25H38N2O6 — CID 159663662
tert-butyl 3-[(5-hydroxy-4-oxopentyl)carbamoyl]-7-(phenacylamino)heptanoate (PubChem CID 159663662) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is tert-butyl 3-[(5-hydroxy-4-oxopentyl)carbamoyl]-7-(phenacylamino)heptanoate.
| Compound Name | tert-butyl 3-[(5-hydroxy-4-oxopentyl)carbamoyl]-7-(phenacylamino)heptanoate |
|---|---|
| PubChem CID | 159663662 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | tert-butyl 3-[(5-hydroxy-4-oxopentyl)carbamoyl]-7-(phenacylamino)heptanoate |
| SMILES | CC(C)(C)OC(=O)CC(CCCCNCC(=O)c1ccccc1)C(=O)NCCCC(=O)CO |
| InChI | InChI=1S/C25H38N2O6/c1-25(2,3)33-23(31)16-20(24(32)27-15-9-13-21(29)18-28)12-7-8-14-26-17-22(30)19-10-5-4-6-11-19/h4-6,10-11,20,26,28H,7-9,12-18H2,1-3H3,(H,27,32) |
| InChIKey | OMSHANXWWWIMAH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|