C25H23N5O — CID 159663986
1-[6-[4-(3H-isoindol-5-ylamino)pyrimidin-2-yl]-1H-indol-2-yl]-3-methylbutan-1-one (PubChem CID 159663986) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-[6-[4-(3H-isoindol-5-ylamino)pyrimidin-2-yl]-1H-indol-2-yl]-3-methylbutan-1-one.
| Compound Name | 1-[6-[4-(3H-isoindol-5-ylamino)pyrimidin-2-yl]-1H-indol-2-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 159663986 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-[6-[4-(3H-isoindol-5-ylamino)pyrimidin-2-yl]-1H-indol-2-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)c1cc2ccc(-c3nccc(Nc4ccc5c(c4)CN=C5)n3)cc2[nH]1 |
| InChI | InChI=1S/C25H23N5O/c1-15(2)9-23(31)22-11-16-3-4-17(12-21(16)29-22)25-27-8-7-24(30-25)28-20-6-5-18-13-26-14-19(18)10-20/h3-8,10-13,15,29H,9,14H2,1-2H3,(H,27,28,30) |
| InChIKey | MTDZOHNRUMNSHV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |