C11H9BF2NO4 — CID 159665167
CID 159665167 (PubChem CID 159665167) has the molecular formula C11H9BF2NO4 and a molecular weight of 268.00 g/mol.
| Compound Name | CID 159665167 |
|---|---|
| PubChem CID | 159665167 |
| Molecular Formula | C11H9BF2NO4 |
| Molecular Weight | 268.00 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | — |
| SMILES | COn1cc(C(=O)O)c(=O)c2ccccc21.F[B]F |
| InChI | InChI=1S/C11H9NO4.BF2/c1-16-12-6-8(11(14)15)10(13)7-4-2-3-5-9(7)12;2-1-3/h2-6H,1H3,(H,14,15); |
| InChIKey | MTHUUDXMNILNPK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.00 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|