About 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane
6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane (PubChem CID 159665486) has the molecular formula C16H38NO4P
and a molecular weight of 339.46 g/mol. Its IUPAC name is 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane.
Molecular Properties
| Compound Name | 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane |
| PubChem CID | 159665486 |
| Molecular Formula | C16H38NO4P |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane |
| SMILES | C.C.CCCCCCOP(C)(=NC)OCCCCCC(=O)O |
| InChI | InChI=1S/C14H30NO4P.2CH4/c1-4-5-6-9-12-18-20(3,15-2)19-13-10-7-8-11-14(16)17;;/h4-13H2,1-3H3,(H,16,17);2*1H4 |
| InChIKey | MTIRKWGGERKPCM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane?
The IUPAC name of 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane (CID 159665486) is 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane.
What is the SMILES notation for 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane?
The canonical SMILES for 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane is C.C.CCCCCCOP(C)(=NC)OCCCCCC(=O)O.
What is the InChIKey of 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane?
The InChIKey is MTIRKWGGERKPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30NO4P.2CH4/c1-4-5-6-9-12-18-20(3,15-2)19-13-10-7-8-11-14(16)17;;/h4-13H2,1-3H3,(H,16,17);2*1H4.
What are the key properties of 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane?
6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane has a molecular weight of 339.46 g/mol, XLogP of 5.81, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hexoxy-methyl-methylimino-λ5-phosphanyl)oxyhexanoic acid;methane is sourced from PubChem (CID 159665486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).