C25H19BrF8N4O2 — CID 159671734
5-bromo-6-[(2R)-5-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]pyridine-2-carboxamide (PubChem CID 159671734) has the molecular formula C25H19BrF8N4O2 and a molecular weight of 639.34 g/mol. Its IUPAC name is 5-bromo-6-[(2R)-5-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-bromo-6-[(2R)-5-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 159671734 |
| Molecular Formula | C25H19BrF8N4O2 |
| Molecular Weight | 639.34 g/mol |
| Exact Mass | 638.06 |
| IUPAC Name | 5-bromo-6-[(2R)-5-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(Br)c([C@@H](CC(=O)Cn2nc(C(F)F)c3c2C(F)(F)CCC3(F)F)Cc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C25H19BrF8N4O2/c26-16-1-2-17(23(35)40)36-19(16)12(5-11-6-13(27)9-14(28)7-11)8-15(39)10-38-21-18(20(37-38)22(29)30)24(31,32)3-4-25(21,33)34/h1-2,6-7,9,12,22H,3-5,8,10H2,(H2,35,40)/t12-/m1/s1 |
| InChIKey | UYGOPBIEIKVGQB-GFCCVEGCSA-N |
| XLogP | 6.32 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.34 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |