C27H27BrF8N6O3 — CID 90281318
N-[(1S)-1-[5-bromo-2-[2-(2-methoxyethoxy)ethylamino]pyrimidin-4-yl]-2-(3,5-difluorophenyl)ethyl]-2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]acetamide (PubChem CID 90281318) has the molecular formula C27H27BrF8N6O3 and a molecular weight of 715.44 g/mol. Its IUPAC name is N-[(1S)-1-[5-bromo-2-[2-(2-methoxyethoxy)ethylamino]pyrimidin-4-yl]-2-(3,5-difluorophenyl)ethyl]-2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]acetamide.
| Compound Name | N-[(1S)-1-[5-bromo-2-[2-(2-methoxyethoxy)ethylamino]pyrimidin-4-yl]-2-(3,5-difluorophenyl)ethyl]-2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]acetamide |
|---|---|
| PubChem CID | 90281318 |
| Molecular Formula | C27H27BrF8N6O3 |
| Molecular Weight | 715.44 g/mol |
| Exact Mass | 714.12 |
| IUPAC Name | N-[(1S)-1-[5-bromo-2-[2-(2-methoxyethoxy)ethylamino]pyrimidin-4-yl]-2-(3,5-difluorophenyl)ethyl]-2-[3-(difluoromethyl)-4,4,7,7-tetrafluoro-5,6-dihydroindazol-1-yl]acetamide |
| SMILES | COCCOCCNc1ncc(Br)c([C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)F)c3c2C(F)(F)CCC3(F)F)n1 |
| InChI | InChI=1S/C27H27BrF8N6O3/c1-44-6-7-45-5-4-37-25-38-12-17(28)21(40-25)18(10-14-8-15(29)11-16(30)9-14)39-19(43)13-42-23-20(22(41-42)24(31)32)26(33,34)2-3-27(23,35)36/h8-9,11-12,18,24H,2-7,10,13H2,1H3,(H,39,43)(H,37,38,40)/t18-/m0/s1 |
| InChIKey | NKNRXAZUNCQKGP-SFHVURJKSA-N |
| XLogP | 5.80 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|