C14H18N2O2 — CID 159672097
4-isocyano-2,3,6,7-tetrahydrooxepine;5-isocyano-2,3,4,7-tetrahydrooxepine (PubChem CID 159672097) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-isocyano-2,3,6,7-tetrahydrooxepine;5-isocyano-2,3,4,7-tetrahydrooxepine.
| Compound Name | 4-isocyano-2,3,6,7-tetrahydrooxepine;5-isocyano-2,3,4,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 159672097 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-isocyano-2,3,6,7-tetrahydrooxepine;5-isocyano-2,3,4,7-tetrahydrooxepine |
| SMILES | [C-]#[N+]C1=CCCOCC1.[C-]#[N+]C1=CCOCCC1 |
| InChI | InChI=1S/2C7H9NO/c2*1-8-7-3-2-5-9-6-4-7/h4H,2-3,5-6H2;3H,2,4-6H2 |
| InChIKey | MUCYETVZISXJEN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|