C28H39N5O5S — CID 159672827
(3aR,6S,6aR)-1-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-4-methylsulfonyl-N-quinolin-5-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide (PubChem CID 159672827) has the molecular formula C28H39N5O5S and a molecular weight of 557.72 g/mol. Its IUPAC name is (3aR,6S,6aR)-1-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-4-methylsulfonyl-N-quinolin-5-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-1-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-4-methylsulfonyl-N-quinolin-5-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 159672827 |
| Molecular Formula | C28H39N5O5S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | (3aR,6S,6aR)-1-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-4-methylsulfonyl-N-quinolin-5-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide |
| SMILES | CC[C@@H](C)C(=O)N[C@H](C(=O)N1CC[C@@H]2[C@H]1[C@@H](C(=O)Nc1cccc3ncccc13)CN2S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C28H39N5O5S/c1-7-17(2)25(34)31-24(28(3,4)5)27(36)32-15-13-22-23(32)19(16-33(22)39(6,37)38)26(35)30-21-12-8-11-20-18(21)10-9-14-29-20/h8-12,14,17,19,22-24H,7,13,15-16H2,1-6H3,(H,30,35)(H,31,34)/t17-,19+,22-,23-,24-/m1/s1 |
| InChIKey | MUFDOQHEXPUSSW-BAKSZIAMSA-N |
| XLogP | 2.61 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |