C36H40BrN5O6 — CID 159673723
4-amino-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide;N-benzyl-4-bromo-N-(oxan-2-yloxy)pyridine-2-carboxamide (PubChem CID 159673723) has the molecular formula C36H40BrN5O6 and a molecular weight of 718.65 g/mol. Its IUPAC name is 4-amino-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide;N-benzyl-4-bromo-N-(oxan-2-yloxy)pyridine-2-carboxamide.
| Compound Name | 4-amino-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide;N-benzyl-4-bromo-N-(oxan-2-yloxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 159673723 |
| Molecular Formula | C36H40BrN5O6 |
| Molecular Weight | 718.65 g/mol |
| Exact Mass | 717.22 |
| IUPAC Name | 4-amino-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide;N-benzyl-4-bromo-N-(oxan-2-yloxy)pyridine-2-carboxamide |
| SMILES | Nc1ccnc(C(=O)N(Cc2ccccc2)OC2CCCCO2)c1.O=C(c1cc(Br)ccn1)N(Cc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C18H19BrN2O3.C18H21N3O3/c2*19-15-9-10-20-16(12-15)18(22)21(13-14-6-2-1-3-7-14)24-17-8-4-5-11-23-17/h1-3,6-7,9-10,12,17H,4-5,8,11,13H2;1-3,6-7,9-10,12,17H,4-5,8,11,13H2,(H2,19,20) |
| InChIKey | MUIFVCAJPZFCMY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|