C18H19N5O3 — CID 86681778
4-azido-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide (PubChem CID 86681778) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-azido-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide.
| Compound Name | 4-azido-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86681778 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-azido-N-benzyl-N-(oxan-2-yloxy)pyridine-2-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccnc(C(=O)N(Cc2ccccc2)OC2CCCCO2)c1 |
| InChI | InChI=1S/C18H19N5O3/c19-22-21-15-9-10-20-16(12-15)18(24)23(13-14-6-2-1-3-7-14)26-17-8-4-5-11-25-17/h1-3,6-7,9-10,12,17H,4-5,8,11,13H2 |
| InChIKey | OKJDLVAAPAUEAC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 100.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|