C18H29NO5 — CID 159677227
(E,4R)-4-ethyl-6-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]-6-oxohex-2-enoic acid (PubChem CID 159677227) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is (E,4R)-4-ethyl-6-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]-6-oxohex-2-enoic acid.
| Compound Name | (E,4R)-4-ethyl-6-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]-6-oxohex-2-enoic acid |
|---|---|
| PubChem CID | 159677227 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (E,4R)-4-ethyl-6-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]-6-oxohex-2-enoic acid |
| SMILES | CC[C@@H](/C=C/C(=O)O)CC(=O)[C@@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO5/c1-5-13(9-10-16(21)22)12-15(20)14-8-6-7-11-19(14)17(23)24-18(2,3)4/h9-10,13-14H,5-8,11-12H2,1-4H3,(H,21,22)/b10-9+/t13-,14-/m0/s1 |
| InChIKey | OIDODYAZNKCNHQ-KYXFNPKGSA-N |
| XLogP | 3.40 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|