C16H18FN3O4 — CID 159678850
5-fluoro-5-nitrocyclohexa-1,3-diene;1-(2-nitrophenyl)pyrrolidine (PubChem CID 159678850) has the molecular formula C16H18FN3O4 and a molecular weight of 335.34 g/mol. Its IUPAC name is 5-fluoro-5-nitrocyclohexa-1,3-diene;1-(2-nitrophenyl)pyrrolidine.
| Compound Name | 5-fluoro-5-nitrocyclohexa-1,3-diene;1-(2-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 159678850 |
| Molecular Formula | C16H18FN3O4 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-fluoro-5-nitrocyclohexa-1,3-diene;1-(2-nitrophenyl)pyrrolidine |
| SMILES | O=[N+]([O-])C1(F)C=CC=CC1.O=[N+]([O-])c1ccccc1N1CCCC1 |
| InChI | InChI=1S/C10H12N2O2.C6H6FNO2/c13-12(14)10-6-2-1-5-9(10)11-7-3-4-8-11;7-6(8(9)10)4-2-1-3-5-6/h1-2,5-6H,3-4,7-8H2;1-4H,5H2 |
| InChIKey | MUYNKWYHMSQTEK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|