C30H26N6O4 — CID 159680634
6-(3-aminophenyl)-1-methylindazole-3-carboxylic acid;methyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate (PubChem CID 159680634) has the molecular formula C30H26N6O4 and a molecular weight of 534.58 g/mol. Its IUPAC name is 6-(3-aminophenyl)-1-methylindazole-3-carboxylic acid;methyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate.
| Compound Name | 6-(3-aminophenyl)-1-methylindazole-3-carboxylic acid;methyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 159680634 |
| Molecular Formula | C30H26N6O4 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 6-(3-aminophenyl)-1-methylindazole-3-carboxylic acid;methyl 6-(3-aminophenyl)-1H-indazole-3-carboxylate |
| SMILES | COC(=O)c1n[nH]c2cc(-c3cccc(N)c3)ccc12.Cn1nc(C(=O)O)c2ccc(-c3cccc(N)c3)cc21 |
| InChI | InChI=1S/2C15H13N3O2/c1-18-13-8-10(9-3-2-4-11(16)7-9)5-6-12(13)14(17-18)15(19)20;1-20-15(19)14-12-6-5-10(8-13(12)17-18-14)9-3-2-4-11(16)7-9/h2-8H,16H2,1H3,(H,19,20);2-8H,16H2,1H3,(H,17,18) |
| InChIKey | MVDYCZNBFLXMPL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|