About 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide
2-methoxy-6-nitroaniline;tetrabutylazanium;iodide (PubChem CID 159681209) has the molecular formula C23H44IN3O3
and a molecular weight of 537.53 g/mol. Its IUPAC name is 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide.
Molecular Properties
| Compound Name | 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide |
| PubChem CID | 159681209 |
| Molecular Formula | C23H44IN3O3 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.COc1cccc([N+](=O)[O-])c1N.[I-] |
| InChI | InChI=1S/C16H36N.C7H8N2O3.HI/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-12-6-4-2-3-5(7(6)8)9(10)11;/h5-16H2,1-4H3;2-4H,8H2,1H3;1H/q+1;;/p-1 |
| InChIKey | MVFMRBZVOKOBRG-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide?
The IUPAC name of 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide (CID 159681209) is 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide.
What is the SMILES notation for 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide?
The canonical SMILES for 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide is CCCC[N+](CCCC)(CCCC)CCCC.COc1cccc([N+](=O)[O-])c1N.[I-].
What is the InChIKey of 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide?
The InChIKey is MVFMRBZVOKOBRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C7H8N2O3.HI/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-12-6-4-2-3-5(7(6)8)9(10)11;/h5-16H2,1-4H3;2-4H,8H2,1H3;1H/q+1;;/p-1.
What are the key properties of 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide?
2-methoxy-6-nitroaniline;tetrabutylazanium;iodide has a molecular weight of 537.53 g/mol, XLogP of 3.19, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-nitroaniline;tetrabutylazanium;iodide is sourced from PubChem (CID 159681209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).