C41H38F2N4O2 — CID 159681518
ethyl 3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine-1-carboxylate;3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine (PubChem CID 159681518) has the molecular formula C41H38F2N4O2 and a molecular weight of 656.78 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine-1-carboxylate;3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine.
| Compound Name | ethyl 3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine-1-carboxylate;3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine |
|---|---|
| PubChem CID | 159681518 |
| Molecular Formula | C41H38F2N4O2 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine-1-carboxylate;3-(4-fluorophenyl)-2-pyridin-4-yl-5,6,7,8-tetrahydroindolizine |
| SMILES | CCOC(=O)c1c(-c2ccncc2)c(-c2ccc(F)cc2)n2c1CCCC2.Fc1ccc(-c2c(-c3ccncc3)cc3n2CCCC3)cc1 |
| InChI | InChI=1S/C22H21FN2O2.C19H17FN2/c1-2-27-22(26)20-18-5-3-4-14-25(18)21(16-6-8-17(23)9-7-16)19(20)15-10-12-24-13-11-15;20-16-6-4-15(5-7-16)19-18(14-8-10-21-11-9-14)13-17-3-1-2-12-22(17)19/h6-13H,2-5,14H2,1H3;4-11,13H,1-3,12H2 |
| InChIKey | MVGLWPPMDDPQSB-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |