C22H18N4O2 — CID 159684415
2-(6-amino-1H-benzimidazol-2-yl)-5-(6-methyl-3H-indol-2-yl)benzene-1,4-diol (PubChem CID 159684415) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(6-amino-1H-benzimidazol-2-yl)-5-(6-methyl-3H-indol-2-yl)benzene-1,4-diol.
| Compound Name | 2-(6-amino-1H-benzimidazol-2-yl)-5-(6-methyl-3H-indol-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 159684415 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(6-amino-1H-benzimidazol-2-yl)-5-(6-methyl-3H-indol-2-yl)benzene-1,4-diol |
| SMILES | Cc1ccc2c(c1)N=C(c1cc(O)c(-c3nc4ccc(N)cc4[nH]3)cc1O)C2 |
| InChI | InChI=1S/C22H18N4O2/c1-11-2-3-12-7-18(24-17(12)6-11)14-9-21(28)15(10-20(14)27)22-25-16-5-4-13(23)8-19(16)26-22/h2-6,8-10,27-28H,7,23H2,1H3,(H,25,26) |
| InChIKey | DXTKSNUJEQGIKA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|