C29H29F3N4O3S — CID 159686851
tert-butyl 2-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (PubChem CID 159686851) has the molecular formula C29H29F3N4O3S and a molecular weight of 570.64 g/mol. Its IUPAC name is tert-butyl 2-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 159686851 |
| Molecular Formula | C29H29F3N4O3S |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | tert-butyl 2-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc(-c3ccn4c(-c5cccc(CC(=O)CCC(F)(F)F)c5)cnc4c3)sc2C1 |
| InChI | InChI=1S/C29H29F3N4O3S/c1-28(2,3)39-27(38)35-11-9-22-24(17-35)40-26(34-22)20-8-12-36-23(16-33-25(36)15-20)19-6-4-5-18(13-19)14-21(37)7-10-29(30,31)32/h4-6,8,12-13,15-16H,7,9-11,14,17H2,1-3H3 |
| InChIKey | MVXFNBZSMFXQFN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |