C25H27F3N4O2 — CID 76661878
5,5,5-trifluoro-1-[3-[7-[(1-methylpiperidin-4-yl)oxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 76661878) has the molecular formula C25H27F3N4O2 and a molecular weight of 472.51 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(1-methylpiperidin-4-yl)oxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(1-methylpiperidin-4-yl)oxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 76661878 |
| Molecular Formula | C25H27F3N4O2 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(1-methylpiperidin-4-yl)oxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | CN1CCC(ON=Cc2ccn3c(-c4cccc(CC(=O)CCC(F)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C25H27F3N4O2/c1-31-10-7-22(8-11-31)34-30-16-19-6-12-32-23(17-29-24(32)15-19)20-4-2-3-18(13-20)14-21(33)5-9-25(26,27)28/h2-4,6,12-13,15-17,22H,5,7-11,14H2,1H3 |
| InChIKey | CWSLYMXVDPFFCJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|