C31H37F2N5O2 — CID 162157686
1-[3-[7-[3-(4-but-3-ynylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5-difluorohexan-2-one (PubChem CID 162157686) has the molecular formula C31H37F2N5O2 and a molecular weight of 549.67 g/mol. Its IUPAC name is 1-[3-[7-[3-(4-but-3-ynylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5-difluorohexan-2-one.
| Compound Name | 1-[3-[7-[3-(4-but-3-ynylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5-difluorohexan-2-one |
|---|---|
| PubChem CID | 162157686 |
| Molecular Formula | C31H37F2N5O2 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 1-[3-[7-[3-(4-but-3-ynylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5-difluorohexan-2-one |
| SMILES | C#CCCN1CCN(CCCON=Cc2ccn3c(-c4cccc(CC(=O)CCC(C)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C31H37F2N5O2/c1-3-4-12-36-15-17-37(18-16-36)13-6-19-40-35-23-26-10-14-38-29(24-34-30(38)22-26)27-8-5-7-25(20-27)21-28(39)9-11-31(2,32)33/h1,5,7-8,10,14,20,22-24H,4,6,9,11-13,15-19,21H2,2H3 |
| InChIKey | DMRISQKCSCLCHX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|