C25H21F3N4O2 — CID 76661841
5,5,5-trifluoro-1-[3-[7-(pyridin-3-ylmethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 76661841) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-(pyridin-3-ylmethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-(pyridin-3-ylmethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 76661841 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-(pyridin-3-ylmethoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1cccc(-c2cnc3cc(C=NOCc4cccnc4)ccn23)c1 |
| InChI | InChI=1S/C25H21F3N4O2/c26-25(27,28)8-6-22(33)12-18-3-1-5-21(11-18)23-16-30-24-13-19(7-10-32(23)24)15-31-34-17-20-4-2-9-29-14-20/h1-5,7,9-11,13-16H,6,8,12,17H2 |
| InChIKey | WNBFCSBNKVBAIS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 68.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|