C22H21ClF3N3O2 — CID 76661810
1-[3-[7-(3-chloropropoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one (PubChem CID 76661810) has the molecular formula C22H21ClF3N3O2 and a molecular weight of 451.88 g/mol. Its IUPAC name is 1-[3-[7-(3-chloropropoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-[3-[7-(3-chloropropoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 76661810 |
| Molecular Formula | C22H21ClF3N3O2 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-[3-[7-(3-chloropropoxyiminomethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1cccc(-c2cnc3cc(C=NOCCCCl)ccn23)c1 |
| InChI | InChI=1S/C22H21ClF3N3O2/c23-8-2-10-31-28-14-17-6-9-29-20(15-27-21(29)13-17)18-4-1-3-16(11-18)12-19(30)5-7-22(24,25)26/h1,3-4,6,9,11,13-15H,2,5,7-8,10,12H2 |
| InChIKey | HZRXDMPYQAVMAR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|